![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 12. Phieu dang ki thao luan.pdf | 18-Apr-2019 08:38 | 260K | |
| 11. To trinh niem yet tren san giao dich HOSE.pdf | 18-Apr-2019 08:38 | 507K | |
| 10. To trinh lua chon don vi kiem toan BCTC 2018.pdf | 18-Apr-2019 08:38 | 368K | |
| 09. To trinh phe duyet quyet toan quy tien luong thu lao HDQT va BKS.pdf | 18-Apr-2019 08:38 | 685K | |
| 08. To trinh phan phoi loi nhuan 2017.pdf | 18-Apr-2019 08:38 | 277K | |
| 07. To trinh thong qua BCTC 2017 (kem bang so lieu tai chinh).pdf | 18-Apr-2019 08:38 | 5.6M | |
| 06. Bao cao ket qua SXKD - Ban dieu hanh.pdf | 18-Apr-2019 08:38 | 3.0M | |
| 05. Bao cao ket qua hoat dong BKS.pdf | 18-Apr-2019 08:38 | 3.6M | |
| 04. Bao cao ket qua hoat dong HDQT.pdf | 18-Apr-2019 08:38 | 2.5M | |
| 03. To trinh thong qua Quy che noi bo ve quan tri (kem du thao Quy che).pdf | 18-Apr-2019 08:38 | 7.7M | |
| 02. To trinh sua doi Dieu le (kem du thao Dieu le).pdf | 18-Apr-2019 08:38 | 15M | |
| 01. Quy che to chuc DHDCD 2018.pdf | 18-Apr-2019 08:38 | 1.5M | |